Compound Q&A

What industries use 17-Hydroxy-3,20-dioxopregn-4-en-21-yl acetate (CAS: 640-87-9)?

Answer

17-Hydroxy-3,20-dioxopregn-4-en-21-yl acetate
17-Hydroxy-3,20-dioxopregn-4-en-21-yl acetate (CAS: 640-87-9) finds applications in the pharmaceutical industry, particularly in the development of steroid-based drugs. It is also used in the production of certain types of polymers and as a reagent in analytical chemistry for developing sensor technologies. Its use in semiconductor manufacturing is less common but possible, depending on specific applications.

About

CAS No 640-87-9
English Name 17-Hydroxy-3,20-dioxopregn-4-en-21-yl acetate
Molecular Formula C23H32O5
Molecular Weight 388.5 g/mol
SMILES CC(=O)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C
InChIKey HPAKILCZTKWIFK-JZTHCNPZSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 17-Hydroxy-3,20-dioxopregn-4-en-21-yl acetate (CAS: 640-87-9)?

17-Hydroxy-3,20-dioxopregn-4-en-21-yl acetate (CAS: 640-87-9) is a colorless crystalline compound wi...

Compound Q&A

How is 17-Hydroxy-3,20-dioxopregn-4-en-21-yl acetate (CAS: 640-87-9) typically synthesized?

17-Hydroxy-3,20-dioxopregn-4-en-21-yl acetate (CAS: 640-87-9) is synthesized via multiple steps invo...

Compound Q&A

What precautions should be taken when handling 17-Hydroxy-3,20-dioxopregn-4-en-21-yl acetate (CAS: 640-87-9)?

When handling 17-Hydroxy-3,20-dioxopregn-4-en-21-yl acetate (CAS: 640-87-9), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...