Compound Q&A

How is potassium trifluoro[(morpholin-4-yl)methyl]boranuide (CAS: 936329-94-1) typically synthesized?

Answer

potassium trifluoro[(morpholin-4-yl)methyl]boranuide
Potassium trifluoro[(morpholin-4-yl)methyl]boranuide is synthesized via a multi-step process, involving the reaction of boronic acid derivatives with trifluoro[(morpholin-4-yl)methyl]amine. The synthesis typically requires careful control of reaction conditions, including temperature and solvent choice, to ensure high yield and selectivity. Catalysts such as palladium or ruthenium are often used to enhance the reaction efficiency.

About

English Name potassium trifluoro[(morpholin-4-yl)methyl]boranuide
Molecular Formula C5H10BF3KNO
Molecular Weight 207.05 g/mol
SMILES [B-](CN1CCOCC1)(F)(F)F.[K+]
InChIKey KYDJCUCIKMUKQU-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of potassium trifluoro[(morpholin-4-yl)methyl]boranuide (CAS: 936329-94-1)?

Potassium trifluoro[(morpholin-4-yl)methyl]boranuide is a white crystalline solid with a molecular w...

Compound Q&A

What industries use potassium trifluoro[(morpholin-4-yl)methyl]boranuide (CAS: 936329-94-1)?

Potassium trifluoro[(morpholin-4-yl)methyl]boranuide is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling potassium trifluoro[(morpholin-4-yl)methyl]boranuide (CAS: 936329-94-1)?

When handling potassium trifluoro[(morpholin-4-yl)methyl]boranuide, it is crucial to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...