Compound Q&A

What are the physical and chemical properties of potassium trifluoro[(morpholin-4-yl)methyl]boranuide (CAS: 936329-94-1)?

Answer

potassium trifluoro[(morpholin-4-yl)methyl]boranuide
Potassium trifluoro[(morpholin-4-yl)methyl]boranuide is a white crystalline solid with a molecular weight of approximately 303.87 g/mol. It is slightly soluble in water and ethanol. The compound is reactive towards acidic and basic conditions, making it sensitive to pH changes. It is also sensitive to moisture and air, leading to hydrolysis and oxidation reactions.

About

English Name potassium trifluoro[(morpholin-4-yl)methyl]boranuide
Molecular Formula C5H10BF3KNO
Molecular Weight 207.05 g/mol
SMILES [B-](CN1CCOCC1)(F)(F)F.[K+]
InChIKey KYDJCUCIKMUKQU-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

How is potassium trifluoro[(morpholin-4-yl)methyl]boranuide (CAS: 936329-94-1) typically synthesized?

Potassium trifluoro[(morpholin-4-yl)methyl]boranuide is synthesized via a multi-step process, involv...

Compound Q&A

What industries use potassium trifluoro[(morpholin-4-yl)methyl]boranuide (CAS: 936329-94-1)?

Potassium trifluoro[(morpholin-4-yl)methyl]boranuide is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling potassium trifluoro[(morpholin-4-yl)methyl]boranuide (CAS: 936329-94-1)?

When handling potassium trifluoro[(morpholin-4-yl)methyl]boranuide, it is crucial to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...