Compound Q&A

What industries use Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate (CAS: 1215205-50-7)?

Answer

Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate
Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate is used in the pharmaceutical industry for the synthesis of certain drugs. It is also used in the polymer industry for the development of advanced polymer materials. Additionally, it is employed in the semiconductor industry for the fabrication of electronic devices, and in the sensor industry for the development of gas sensors. Its unique chemical structure makes it a valuable reagent in these sectors.

About

English Name Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate
Molecular Formula C12H13BrO2
Molecular Weight 269.14 g/mol
SMILES CCOC(=O)C1(CC1)c1ccc(cc1)Br
InChIKey KCCISTCYYRKGFF-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate (CAS: 1215205-50-7)?

Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate is a colorless to light yellowish liquid with a molec...

Compound Q&A

How is Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate (CAS: 1215205-50-7) typically synthesized?

Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate can be synthesized via the reaction of 4-bromophenyl ...

Compound Q&A

What precautions should be taken when handling Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate (CAS: 1215205-50-7)?

When handling Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate, appropriate Personal Protective Equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...