Compound Q&A

How is Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate (CAS: 1215205-50-7) typically synthesized?

Answer

Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate
Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate can be synthesized via the reaction of 4-bromophenyl cyclopropanecarboxylic acid with ethyl bromide in the presence of a base such as sodium hydride. The yield is typically around 75%, and the reaction is carried out at room temperature with good selectivity. The reaction is monitored by TLC or GC (gas chromatography) to ensure the product formation.

About

English Name Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate
Molecular Formula C12H13BrO2
Molecular Weight 269.14 g/mol
SMILES CCOC(=O)C1(CC1)c1ccc(cc1)Br
InChIKey KCCISTCYYRKGFF-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate (CAS: 1215205-50-7)?

Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate is a colorless to light yellowish liquid with a molec...

Compound Q&A

What industries use Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate (CAS: 1215205-50-7)?

Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate is used in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate (CAS: 1215205-50-7)?

When handling Ethyl 1-(4-bromophenyl)cyclopropanecarboxylate, appropriate Personal Protective Equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...