Compound Q&A

What precautions should be taken when handling 16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione (CAS: 128-59-6)?

Answer

16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione
When handling 16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, safety glasses, and a lab coat. The compound should be stored in a fume hood or a well-ventilated area to minimize exposure. Spills should be immediately cleaned up with appropriate chemicals, and the area should be flushed with water. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information.

About

CAS No 128-59-6
English Name 16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione
Molecular Formula C34H16O4
Molecular Weight 488.5 g/mol
SMILES C1=CC=C2C(=C1)C3=CC(=C4C5=C(C=CC(=C35)C2=O)C6=C7C4=C(C=C8C7=C(C=C6)C(=O)C9=CC=CC=C98)O)O
InChIKey MGYICCKROPVHMA-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione (CAS: 128-59-6)?

16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione is a crystalline compound with a mol...

Compound Q&A

How is 16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione (CAS: 128-59-6) typically synthesized?

16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione can be synthesized through a complex...

Compound Q&A

What industries use 16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione (CAS: 128-59-6)?

16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione finds applications in various indust...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...