Compound Q&A

What are the physical and chemical properties of 16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione (CAS: 128-59-6)?

Answer

16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione
16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione is a crystalline compound with a molecular weight of approximately 828.65 g/mol. It has a low solubility in common organic solvents like ethanol and acetone but is soluble in more polar solvents such as dimethylformamide (DMF). The compound is moderately reactive, showing some tendency for ring-opening reactions under certain conditions. It exhibits strong UV-Vis absorption in the visible region, making it useful in various spectroscopic studies.

About

CAS No 128-59-6
English Name 16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione
Molecular Formula C34H16O4
Molecular Weight 488.5 g/mol
SMILES C1=CC=C2C(=C1)C3=CC(=C4C5=C(C=CC(=C35)C2=O)C6=C7C4=C(C=C8C7=C(C=C6)C(=O)C9=CC=CC=C98)O)O
InChIKey MGYICCKROPVHMA-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is 16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione (CAS: 128-59-6) typically synthesized?

16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione can be synthesized through a complex...

Compound Q&A

What industries use 16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione (CAS: 128-59-6)?

16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione finds applications in various indust...

Compound Q&A

What precautions should be taken when handling 16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione (CAS: 128-59-6)?

When handling 16,17-Dihydroxyanthra[9,1,2-cde]benzo[rst]pentaphene-5,10-dione, it is crucial to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...