Compound Q&A

What are the physical and chemical properties of 1-(5-Bromo-6-methoxy-2-naphthyl)ethanone (CAS: 84167-74-8)?

Answer

1-(5-Bromo-6-methoxy-2-naphthyl)ethanone
1-(5-Bromo-6-methoxy-2-naphthyl)ethanone is a white crystalline solid with a molecular weight of approximately 300 g/mol. It has a melting point of around 60-62°C and is slightly soluble in water but more soluble in organic solvents. This compound is less reactive under normal conditions but can undergo nucleophilic substitution reactions. Its stability under various conditions makes it suitable for use in organic synthesis and pharmaceutical applications.

About

CAS No 84167-74-8
English Name 1-(5-Bromo-6-methoxy-2-naphthyl)ethanone
Molecular Formula C13H11BrO2
Molecular Weight 279.13 g/mol
SMILES CC(=O)C1=CC2=C(C=C1)C(=C(C=C2)OC)Br
InChIKey KDDYYAXVVDTNND-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is 1-(5-Bromo-6-methoxy-2-naphthyl)ethanone (CAS: 84167-74-8) typically synthesized?

1-(5-Bromo-6-methoxy-2-naphthyl)ethanone is typically synthesized via a Friedel-Crafts acylation rea...

Compound Q&A

What industries use 1-(5-Bromo-6-methoxy-2-naphthyl)ethanone (CAS: 84167-74-8)?

1-(5-Bromo-6-methoxy-2-naphthyl)ethanone (CAS: 84167-74-8) is primarily used in the pharmaceutical a...

Compound Q&A

What precautions should be taken when handling 1-(5-Bromo-6-methoxy-2-naphthyl)ethanone (CAS: 84167-74-8)?

When handling 1-(5-Bromo-6-methoxy-2-naphthyl)ethanone (CAS: 84167-74-8), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...