Compound Q&A

What industries use 2-[(3-Chlorophenyl)amino]benzoic acid (CAS: 13278-36-9)?

Answer

2-[(3-Chlorophenyl)amino]benzoic acid
2-[(3-Chlorophenyl)amino]benzoic acid is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also utilized in the polymer industry for the development of specialty polymers and in the sensor industry for its reactivity towards specific chemical species. Additionally, it finds use in the semiconductor industry as a dopant.

About

CAS No 13278-36-9
English Name 2-[(3-Chlorophenyl)amino]benzoic acid
Molecular Formula C13H10ClNO2
Molecular Weight 247.68 g/mol
SMILES C1=CC=C(C(=C1)C(=O)O)NC2=CC(=CC=C2)Cl
InChIKey OVMWPVYEBVFZHM-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[(3-Chlorophenyl)amino]benzoic acid (CAS: 13278-36-9)?

2-[(3-Chlorophenyl)amino]benzoic acid is a white solid with a crystalline form. The molecular weight...

Compound Q&A

How is 2-[(3-Chlorophenyl)amino]benzoic acid (CAS: 13278-36-9) typically synthesized?

2-[(3-Chlorophenyl)amino]benzoic acid is typically synthesized via the reaction of 3-chloroaniline a...

Compound Q&A

What precautions should be taken when handling 2-[(3-Chlorophenyl)amino]benzoic acid (CAS: 13278-36-9)?

When handling 2-[(3-Chlorophenyl)amino]benzoic acid, it is important to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...