Compound Q&A

How is 2-[(3-Chlorophenyl)amino]benzoic acid (CAS: 13278-36-9) typically synthesized?

Answer

2-[(3-Chlorophenyl)amino]benzoic acid
2-[(3-Chlorophenyl)amino]benzoic acid is typically synthesized via the reaction of 3-chloroaniline and benzoic anhydride. The process involves heating the mixture to form the amide bond. Common solvents include toluene and ethanol. The yield is usually around 70-80%. The reaction is carried out under mild conditions to ensure selectivity and high purity.

About

CAS No 13278-36-9
English Name 2-[(3-Chlorophenyl)amino]benzoic acid
Molecular Formula C13H10ClNO2
Molecular Weight 247.68 g/mol
SMILES C1=CC=C(C(=C1)C(=O)O)NC2=CC(=CC=C2)Cl
InChIKey OVMWPVYEBVFZHM-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[(3-Chlorophenyl)amino]benzoic acid (CAS: 13278-36-9)?

2-[(3-Chlorophenyl)amino]benzoic acid is a white solid with a crystalline form. The molecular weight...

Compound Q&A

What industries use 2-[(3-Chlorophenyl)amino]benzoic acid (CAS: 13278-36-9)?

2-[(3-Chlorophenyl)amino]benzoic acid is primarily used in the pharmaceutical industry as an interme...

Compound Q&A

What precautions should be taken when handling 2-[(3-Chlorophenyl)amino]benzoic acid (CAS: 13278-36-9)?

When handling 2-[(3-Chlorophenyl)amino]benzoic acid, it is important to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...