Compound Q&A

What industries use 3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine (CAS: 869335-20-6)?

Answer

3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is primarily used in the pharmaceutical industry for drug discovery and development. It is also of interest in the polymer industry due to its potential as a cross-linking agent. Additionally, it has applications in the synthesis of sensors and semiconductors, where its unique chemical structure can be exploited.

About

English Name 3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
Molecular Formula C14H10ClIN2O2S
Molecular Weight 418.6430000000001 g/mol
SMILES IC1=CN(S(=O)(C2=CC=CC=C2)=O)C3=NC=CC(Cl)=C31
InChIKey PRAMTDNFVPNNFG-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine (CAS: 869335-20-6)?

3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is a crystalline solid with a molecular...

Compound Q&A

How is 3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine (CAS: 869335-20-6) typically synthesized?

3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is typically synthesized through a mult...

Compound Q&A

What precautions should be taken when handling 3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine (CAS: 869335-20-6)?

When handling 3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3]pyridine, it is essential to use app...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...