Compound Q&A

What are the physical and chemical properties of 3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine (CAS: 869335-20-6)?

Answer

3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is a crystalline solid with a molecular weight of approximately 445.36 g/mol. It has a low water solubility and is reasonably soluble in organic solvents such as dichloromethane and acetonitrile. This compound exhibits limited reactivity towards nucleophiles and electrophiles, making it suitable for specific synthetic applications. It is often used in medicinal chemistry due to its structural complexity.

About

English Name 3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
Molecular Formula C14H10ClIN2O2S
Molecular Weight 418.6430000000001 g/mol
SMILES IC1=CN(S(=O)(C2=CC=CC=C2)=O)C3=NC=CC(Cl)=C31
InChIKey PRAMTDNFVPNNFG-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is 3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine (CAS: 869335-20-6) typically synthesized?

3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is typically synthesized through a mult...

Compound Q&A

What industries use 3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine (CAS: 869335-20-6)?

3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling 3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine (CAS: 869335-20-6)?

When handling 3-Iodo-4-chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3]pyridine, it is essential to use app...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...