Compound Q&A

What industries use tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate (CAS: 748805-97-2)?

Answer

tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate
Tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate is used in the pharmaceutical industry as an intermediate for the synthesis of various drugs. It is also utilized in the polymer industry for developing new materials with specific properties. Additionally, it has potential applications in the production of sensors and semiconductors due to its chemical reactivity and stability.

About

English Name tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate
Molecular Formula C10H17NO4
Molecular Weight 215.24899999999994 g/mol
SMILES CC(C)(C)OC(=O)N1CCOCC(=O)C1
InChIKey PFSHWTZFMZJJMP-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate (CAS: 748805-97-2)?

Tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate is a white crystalline solid with a molecular weight of...

Compound Q&A

How is tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate (CAS: 748805-97-2) typically synthesized?

Tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate is typically synthesized via the condensation of tert-b...

Compound Q&A

What precautions should be taken when handling tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate (CAS: 748805-97-2)?

When handling tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate, it is essential to wear appropriate pers...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...