Compound Q&A

How is tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate (CAS: 748805-97-2) typically synthesized?

Answer

tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate
Tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate is typically synthesized via the condensation of tert-butyl 4-carboxylic acid with 6-aminocaproic acid. This reaction is catalyzed by a mild base, and the product is isolated after purification. The process yields up to 90% of the desired product with a high level of selectivity.

About

English Name tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate
Molecular Formula C10H17NO4
Molecular Weight 215.24899999999994 g/mol
SMILES CC(C)(C)OC(=O)N1CCOCC(=O)C1
InChIKey PFSHWTZFMZJJMP-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate (CAS: 748805-97-2)?

Tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate is a white crystalline solid with a molecular weight of...

Compound Q&A

What industries use tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate (CAS: 748805-97-2)?

Tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate is used in the pharmaceutical industry as an intermedia...

Compound Q&A

What precautions should be taken when handling tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate (CAS: 748805-97-2)?

When handling tert-Butyl 6-oxo-1,4-oxazepane-4-carboxylate, it is essential to wear appropriate pers...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...