Compound Q&A

What industries use Dibenzyl oxalate (CAS: 7579-36-4)?

Answer

Dibenzyl oxalate
Dibenzyl oxalate (CAS: 7579-36-4) is used in various industries, including pharmaceuticals for its role as a stabilizer and antioxidant, in polymer synthesis as a modifier, and in the production of sensors and semiconductors where its unique chemical properties are leveraged.

About

CAS No 7579-36-4
English Name Dibenzyl oxalate
Molecular Formula C16H14O4
Molecular Weight 270.28 g/mol
SMILES C1=CC=C(C=C1)COC(=O)C(=O)OCC2=CC=CC=C2
InChIKey ZYZXGWGQYNTGAU-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dibenzyl oxalate (CAS: 7579-36-4)?

Dibenzyl oxalate (CAS: 7579-36-4) is a crystalline compound with a molecular weight of approximately...

Compound Q&A

How is Dibenzyl oxalate (CAS: 7579-36-4) typically synthesized?

Dibenzyl oxalate (CAS: 7579-36-4) is commonly synthesized by the reaction of oxalic acid with benzyl...

Compound Q&A

What precautions should be taken when handling Dibenzyl oxalate (CAS: 7579-36-4)?

When handling Dibenzyl oxalate (CAS: 7579-36-4), it is important to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...