Compound Q&A

What are the physical and chemical properties of Dibenzyl oxalate (CAS: 7579-36-4)?

Answer

Dibenzyl oxalate
Dibenzyl oxalate (CAS: 7579-36-4) is a crystalline compound with a molecular weight of approximately 264.27 g/mol. It has a low solubility in water but is soluble in common organic solvents such as ethanol and acetone. Chemically, it is less reactive compared to other oxalates, showing limited reactivity with metals and other reagents under typical laboratory conditions.

About

CAS No 7579-36-4
English Name Dibenzyl oxalate
Molecular Formula C16H14O4
Molecular Weight 270.28 g/mol
SMILES C1=CC=C(C=C1)COC(=O)C(=O)OCC2=CC=CC=C2
InChIKey ZYZXGWGQYNTGAU-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is Dibenzyl oxalate (CAS: 7579-36-4) typically synthesized?

Dibenzyl oxalate (CAS: 7579-36-4) is commonly synthesized by the reaction of oxalic acid with benzyl...

Compound Q&A

What industries use Dibenzyl oxalate (CAS: 7579-36-4)?

Dibenzyl oxalate (CAS: 7579-36-4) is used in various industries, including pharmaceuticals for its r...

Compound Q&A

What precautions should be taken when handling Dibenzyl oxalate (CAS: 7579-36-4)?

When handling Dibenzyl oxalate (CAS: 7579-36-4), it is important to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...