Compound Q&A

What industries use 2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate (CAS: 1000576-79-3)?

Answer

2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate
2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate is primarily used in the pharmaceutical industry for developing new drug candidates. It is also utilized in research for its unique chemical properties, such as its potential as a biological probe and its ability to interact with specific biomolecules.

About

English Name 2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate
Molecular Formula C9H13BrN2O2S
Molecular Weight 293.19 g/mol
SMILES CN(c1scc(n1)Br)C(=O)OC(C)(C)C
InChIKey BDDLXGFSUQQZHA-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate (CAS: 1000576-79-3)?

2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate is a crystalline solid with a molecula...

Compound Q&A

How is 2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate (CAS: 1000576-79-3) typically synthesized?

2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate is typically synthesized via a multist...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate (CAS: 1000576-79-3)?

When handling 2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate, it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...