Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate (CAS: 1000576-79-3)?

Answer

2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate
2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate is a crystalline solid with a molecular weight of approximately 329.2 g/mol. It is slightly soluble in water but more soluble in organic solvents like methanol and ethanol. This compound exhibits good reactivity towards nucleophiles and can undergo substitution reactions. It is stable under normal conditions but should be stored in a cool, dry place away from direct sunlight.

About

English Name 2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate
Molecular Formula C9H13BrN2O2S
Molecular Weight 293.19 g/mol
SMILES CN(c1scc(n1)Br)C(=O)OC(C)(C)C
InChIKey BDDLXGFSUQQZHA-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate (CAS: 1000576-79-3) typically synthesized?

2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate is typically synthesized via a multist...

Compound Q&A

What industries use 2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate (CAS: 1000576-79-3)?

2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate (CAS: 1000576-79-3)?

When handling 2-Methyl-2-propanyl (4-bromo-1,3-thiazol-2-yl)methylcarbamate, it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...