Compound Q&A

What industries use 3-Acetamido-2,4,6-triiodobenzoic acid (CAS: 85-36-9)?

Answer

3-Acetamido-2,4,6-triiodobenzoic acid
3-Acetamido-2,4,6-triiodobenzoic acid (CAS: 85-36-9) finds application in pharmaceuticals, where it serves as an intermediate in the synthesis of certain drugs. It is also used in the production of sensors due to its unique spectroscopic properties and in the semiconductor industry for its electronic characteristics.

About

CAS No 85-36-9
English Name 3-Acetamido-2,4,6-triiodobenzoic acid
Molecular Formula C9H6I3NO3
Molecular Weight 556.86 g/mol
SMILES CC(=O)NC1=C(C=C(C(=C1I)C(=O)O)I)I
InChIKey GNOGSFBXBWBTIG-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Acetamido-2,4,6-triiodobenzoic acid (CAS: 85-36-9)?

3-Acetamido-2,4,6-triiodobenzoic acid (CAS: 85-36-9) is a crystalline solid with a molecular weight ...

Compound Q&A

How is 3-Acetamido-2,4,6-triiodobenzoic acid (CAS: 85-36-9) typically synthesized?

3-Acetamido-2,4,6-triiodobenzoic acid (CAS: 85-36-9) is typically synthesized by acetylation of 2,4,...

Compound Q&A

What precautions should be taken when handling 3-Acetamido-2,4,6-triiodobenzoic acid (CAS: 85-36-9)?

When handling 3-Acetamido-2,4,6-triiodobenzoic acid (CAS: 85-36-9), ensure the use of personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...