Compound Q&A

How is 3-Acetamido-2,4,6-triiodobenzoic acid (CAS: 85-36-9) typically synthesized?

Answer

3-Acetamido-2,4,6-triiodobenzoic acid
3-Acetamido-2,4,6-triiodobenzoic acid (CAS: 85-36-9) is typically synthesized by acetylation of 2,4,6-triiodobenzoic acid followed by the introduction of an acetamide group. This process involves the use of acetic anhydride and a catalyst such as aluminum chloride. The reaction is carried out under anhydrous conditions to minimize side reactions.

About

CAS No 85-36-9
English Name 3-Acetamido-2,4,6-triiodobenzoic acid
Molecular Formula C9H6I3NO3
Molecular Weight 556.86 g/mol
SMILES CC(=O)NC1=C(C=C(C(=C1I)C(=O)O)I)I
InChIKey GNOGSFBXBWBTIG-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Acetamido-2,4,6-triiodobenzoic acid (CAS: 85-36-9)?

3-Acetamido-2,4,6-triiodobenzoic acid (CAS: 85-36-9) is a crystalline solid with a molecular weight ...

Compound Q&A

What industries use 3-Acetamido-2,4,6-triiodobenzoic acid (CAS: 85-36-9)?

3-Acetamido-2,4,6-triiodobenzoic acid (CAS: 85-36-9) finds application in pharmaceuticals, where it ...

Compound Q&A

What precautions should be taken when handling 3-Acetamido-2,4,6-triiodobenzoic acid (CAS: 85-36-9)?

When handling 3-Acetamido-2,4,6-triiodobenzoic acid (CAS: 85-36-9), ensure the use of personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...