Compound Q&A

What industries use 5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid (CAS: 53980-88-4)?

Answer

5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid
5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid is utilized in the pharmaceutical industry for the synthesis of certain biologically active compounds. It also finds applications in the polymer industry as a monomer or additive. Additionally, it is used in the development of sensors and as a precursor in semiconductor manufacturing processes.

About

CAS No 53980-88-4
English Name 5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid
Molecular Formula C21H36O4
Molecular Weight 352.52 g/mol
SMILES CCCCCCC1C=CC(CC1C(=O)O)CCCCCCCC(=O)O
InChIKey RYKIXDBAIYMFDV-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid (CAS: 53980-88-4)?

5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid is a white crystalline solid with a mole...

Compound Q&A

How is 5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid (CAS: 53980-88-4) typically synthesized?

5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid can be synthesized through a multi-step ...

Compound Q&A

What precautions should be taken when handling 5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid (CAS: 53980-88-4)?

When handling 5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid, it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...