Compound Q&A

What are the physical and chemical properties of 5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid (CAS: 53980-88-4)?

Answer

5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid
5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid is a white crystalline solid with a molecular weight of approximately 362.45 g/mol. It is slightly soluble in common solvents like ethanol and acetone. The compound exhibits typical reactivity of carboxylic acids and cyclohexene derivatives, making it prone to esterification and reduction reactions.

About

CAS No 53980-88-4
English Name 5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid
Molecular Formula C21H36O4
Molecular Weight 352.52 g/mol
SMILES CCCCCCC1C=CC(CC1C(=O)O)CCCCCCCC(=O)O
InChIKey RYKIXDBAIYMFDV-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is 5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid (CAS: 53980-88-4) typically synthesized?

5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid can be synthesized through a multi-step ...

Compound Q&A

What industries use 5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid (CAS: 53980-88-4)?

5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid is utilized in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling 5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid (CAS: 53980-88-4)?

When handling 5-(7-Carboxyheptyl)-2-hexyl-3-cyclohexene-1-carboxylic acid, it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...