Compound Q&A

What industries use 2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate (CAS: 107259-06-3)?

Answer

2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate
2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate is primarily used in the pharmaceutical industry as an intermediate in the synthesis of drugs. It can also be found in the polymer industry as a stabilizer or in the development of new materials. Additionally, it has potential applications in the production of sensors due to its chemical reactivity.

About

English Name 2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate
Molecular Formula C9H15NO3
Molecular Weight 185.22 g/mol
SMILES CC(C)(C)OC(=O)NC1(CC1)C=O
InChIKey ACMHCEYCNRURST-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate (CAS: 107259-06-3)?

The compound 2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate is a crystalline solid with a molecu...

Compound Q&A

How is 2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate (CAS: 107259-06-3) typically synthesized?

2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate is typically synthesized via a multistep process ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate (CAS: 107259-06-3)?

When handling 2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate, it is essential to use personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...