Compound Q&A

How is 2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate (CAS: 107259-06-3) typically synthesized?

Answer

2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate
2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate is typically synthesized via a multistep process involving the formation of a cyclopropyl carbamate followed by the introduction of the formyl group. Commonly used catalysts include acids or bases, and the selectivity is high with good yield. The specific reaction conditions and reagents may vary based on the methodology chosen.

About

English Name 2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate
Molecular Formula C9H15NO3
Molecular Weight 185.22 g/mol
SMILES CC(C)(C)OC(=O)NC1(CC1)C=O
InChIKey ACMHCEYCNRURST-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate (CAS: 107259-06-3)?

The compound 2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate is a crystalline solid with a molecu...

Compound Q&A

What industries use 2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate (CAS: 107259-06-3)?

2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate (CAS: 107259-06-3)?

When handling 2-Methyl-2-propanyl (1-formylcyclopropyl)carbamate, it is essential to use personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...