Compound Q&A

What industries use 2-[(3-Methylphenyl)carbamoyl]benzoic acid (CAS: 85-72-3)?

Answer

2-[(3-Methylphenyl)carbamoyl]benzoic acid
2-[(3-Methylphenyl)carbamoyl]benzoic acid is used in various industries. It is a key intermediate in the production of pharmaceuticals, particularly for drugs targeting metabolic disorders. It also finds applications in the synthesis of organic semiconductors and in the development of chemical sensors due to its unique chemical properties.

About

CAS No 85-72-3
English Name 2-[(3-Methylphenyl)carbamoyl]benzoic acid
Molecular Formula C15H13NO3
Molecular Weight 255.27 g/mol
EINECS 201-626-9
SMILES Cc1cccc(c1)NC(=O)c2ccccc2C(=O)O
InChIKey AZPJXONNBLOZFE-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-[(3-Methylphenyl)carbamoyl]benzoic acid (CAS: 85-72-3)?

2-[(3-Methylphenyl)carbamoyl]benzoic acid is a crystalline solid with a molecular weight of approxim...

Compound Q&A

How is 2-[(3-Methylphenyl)carbamoyl]benzoic acid (CAS: 85-72-3) typically synthesized?

2-[(3-Methylphenyl)carbamoyl]benzoic acid is commonly synthesized via a multi-step process involving...

Compound Q&A

What precautions should be taken when handling 2-[(3-Methylphenyl)carbamoyl]benzoic acid (CAS: 85-72-3)?

Proper handling of 2-[(3-Methylphenyl)carbamoyl]benzoic acid requires attention to safety. It should...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...