Compound Q&A

What are the physical and chemical properties of 2-[(3-Methylphenyl)carbamoyl]benzoic acid (CAS: 85-72-3)?

Answer

2-[(3-Methylphenyl)carbamoyl]benzoic acid
2-[(3-Methylphenyl)carbamoyl]benzoic acid is a crystalline solid with a molecular weight of approximately 273.28 g/mol. It has a pKa value around 4.0, indicating it is a weak acid. The compound is slightly soluble in water but soluble in organic solvents like methanol and ethanol. It is reactive towards bases, undergoing deprotonation, and exhibits ester-like reactivity with nucleophiles.

About

CAS No 85-72-3
English Name 2-[(3-Methylphenyl)carbamoyl]benzoic acid
Molecular Formula C15H13NO3
Molecular Weight 255.27 g/mol
EINECS 201-626-9
SMILES Cc1cccc(c1)NC(=O)c2ccccc2C(=O)O
InChIKey AZPJXONNBLOZFE-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is 2-[(3-Methylphenyl)carbamoyl]benzoic acid (CAS: 85-72-3) typically synthesized?

2-[(3-Methylphenyl)carbamoyl]benzoic acid is commonly synthesized via a multi-step process involving...

Compound Q&A

What industries use 2-[(3-Methylphenyl)carbamoyl]benzoic acid (CAS: 85-72-3)?

2-[(3-Methylphenyl)carbamoyl]benzoic acid is used in various industries. It is a key intermediate in...

Compound Q&A

What precautions should be taken when handling 2-[(3-Methylphenyl)carbamoyl]benzoic acid (CAS: 85-72-3)?

Proper handling of 2-[(3-Methylphenyl)carbamoyl]benzoic acid requires attention to safety. It should...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...