Compound Q&A

How is Benzyl 4-nitrophenyl carbonate (CAS: 13795-24-9) typically synthesized?

Answer

Benzyl 4-nitrophenyl carbonate
Benzyl 4-nitrophenyl carbonate (CAS: 13795-24-9) is typically synthesized via the reaction of benzoic acid and 4-nitrophenol with phosgene. The process is catalyzed by a base such as triethylamine or pyridine, and the reaction is carried out in an inert solvent like methylene chloride. The yield and selectivity of the reaction are highly dependent on the choice of catalyst and reaction conditions.

About

CAS No 13795-24-9
English Name Benzyl 4-nitrophenyl carbonate
Molecular Formula C14H11NO5
Molecular Weight 273.24 g/mol
SMILES C1=CC=C(C=C1)COC(=O)OC2=CC=C(C=C2)[N+](=O)[O-]
InChIKey QIXRWIVDBZJDGD-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl 4-nitrophenyl carbonate (CAS: 13795-24-9)?

Benzyl 4-nitrophenyl carbonate (CAS: 13795-24-9) is a white crystalline solid with a molecular weigh...

Compound Q&A

What industries use Benzyl 4-nitrophenyl carbonate (CAS: 13795-24-9)?

Benzyl 4-nitrophenyl carbonate (CAS: 13795-24-9) is primarily used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling Benzyl 4-nitrophenyl carbonate (CAS: 13795-24-9)?

When handling Benzyl 4-nitrophenyl carbonate (CAS: 13795-24-9), it is essential to use personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...