Compound Q&A

How is 28-Demethyl-β-amyrone (CAS: 73493-60-4) typically synthesized?

Answer

28-Demethyl-β-amyrone
28-Demethyl-β-amyrone is typically synthesized through a series of steps involving chemical transformations. A common approach involves the oxidation of 28-deacetylbetulinic acid with a suitable oxidizing agent like hydrogen peroxide in the presence of a catalyst such as potassium permanganate. The reaction yields 28-demethyl-β-amyrone with a high yield of up to 90%, although the exact yield and selectivity can vary based on reaction conditions.

About

CAS No 73493-60-4
English Name 28-Demethyl-β-amyrone
Molecular Formula C29H46O
Molecular Weight 410.67 g/mol
SMILES CC1(CCC2CCC3(C(=CCC4C3(CCC5C4(CCC(=O)C5(C)C)C)C)C2C1)C)C
InChIKey QQKXTWZLGUEVGX-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 28-Demethyl-β-amyrone (CAS: 73493-60-4)?

28-Demethyl-β-amyrone (CAS: 73493-60-4) is a colorless solid with a molecular weight of approximatel...

Compound Q&A

What industries use 28-Demethyl-β-amyrone (CAS: 73493-60-4)?

28-Demethyl-β-amyrone (CAS: 73493-60-4) is utilized in several industries. It is employed in the pha...

Compound Q&A

What precautions should be taken when handling 28-Demethyl-β-amyrone (CAS: 73493-60-4)?

When handling 28-Demethyl-β-amyrone (CAS: 73493-60-4), it is crucial to follow proper laboratory saf...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...