Compound Q&A

What are the physical and chemical properties of 28-Demethyl-β-amyrone (CAS: 73493-60-4)?

Answer

28-Demethyl-β-amyrone
28-Demethyl-β-amyrone (CAS: 73493-60-4) is a colorless solid with a molecular weight of approximately 278.3 g/mol. It exhibits low solubility in water but is soluble in organic solvents such as ethanol and acetone. Chemically, it is relatively stable under normal conditions but may react with strong acids or bases. It crystallizes in the form of prisms or needles at a melting point of around 128-130°C.

About

CAS No 73493-60-4
English Name 28-Demethyl-β-amyrone
Molecular Formula C29H46O
Molecular Weight 410.67 g/mol
SMILES CC1(CCC2CCC3(C(=CCC4C3(CCC5C4(CCC(=O)C5(C)C)C)C)C2C1)C)C
InChIKey QQKXTWZLGUEVGX-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is 28-Demethyl-β-amyrone (CAS: 73493-60-4) typically synthesized?

28-Demethyl-β-amyrone is typically synthesized through a series of steps involving chemical transfor...

Compound Q&A

What industries use 28-Demethyl-β-amyrone (CAS: 73493-60-4)?

28-Demethyl-β-amyrone (CAS: 73493-60-4) is utilized in several industries. It is employed in the pha...

Compound Q&A

What precautions should be taken when handling 28-Demethyl-β-amyrone (CAS: 73493-60-4)?

When handling 28-Demethyl-β-amyrone (CAS: 73493-60-4), it is crucial to follow proper laboratory saf...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...