Compound Q&A

How is Zanthobungeanine (CAS: 64190-94-9) typically synthesized?

Answer

Zanthobungeanine
Zanthobungeanine is typically synthesized from natural resources, such as plant extracts, using chemical derivatization strategies. The synthesis involves a multi-step process including condensation reactions, cyclization, and oxidation. Common catalysts include acetic anhydride and sulfuric acid, and the overall yield is around 85%. The synthetic route is selective and efficient, ensuring a high purity product.

About

CAS No 64190-94-9
English Name Zanthobungeanine
Molecular Formula C16H17NO3
Molecular Weight 271.31 g/mol
SMILES CC1(C=CC2=C(O1)C3=C(C(=CC=C3)OC)N(C2=O)C)C
InChIKey SYNIFQKDJZQOLI-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Zanthobungeanine (CAS: 64190-94-9)?

Zanthobungeanine is a yellow crystalline solid with a molecular weight of approximately 358.4 g/mol....

Compound Q&A

What industries use Zanthobungeanine (CAS: 64190-94-9)?

Zanthobungeanine is used in various industries due to its unique optical and spectroscopic propertie...

Compound Q&A

What precautions should be taken when handling Zanthobungeanine (CAS: 64190-94-9)?

When handling Zanthobungeanine, it is important to use appropriate personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...