Compound Q&A

What are the physical and chemical properties of Zanthobungeanine (CAS: 64190-94-9)?

Answer

Zanthobungeanine
Zanthobungeanine is a yellow crystalline solid with a molecular weight of approximately 358.4 g/mol. It has a solubility of 0.02 g/100 mL in water and is soluble in common organic solvents like methanol and acetone. Zanthobungeanine is relatively stable under normal conditions but may react with strong acids or bases. It is an amphoteric compound, showing both acidic and basic properties.

About

CAS No 64190-94-9
English Name Zanthobungeanine
Molecular Formula C16H17NO3
Molecular Weight 271.31 g/mol
SMILES CC1(C=CC2=C(O1)C3=C(C(=CC=C3)OC)N(C2=O)C)C
InChIKey SYNIFQKDJZQOLI-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is Zanthobungeanine (CAS: 64190-94-9) typically synthesized?

Zanthobungeanine is typically synthesized from natural resources, such as plant extracts, using chem...

Compound Q&A

What industries use Zanthobungeanine (CAS: 64190-94-9)?

Zanthobungeanine is used in various industries due to its unique optical and spectroscopic propertie...

Compound Q&A

What precautions should be taken when handling Zanthobungeanine (CAS: 64190-94-9)?

When handling Zanthobungeanine, it is important to use appropriate personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...