Compound Q&A

How should (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(1-naphthyl)butanoic acid (CAS: 190190-49-9) be stored?

Answer

(3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(1-naphthyl)butanoic acid
This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to protect it from moisture and air. Ideal storage conditions are between 15-25°C (59-77°F) with minimal humidity exposure.

About

English Name (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(1-naphthyl)butanoic acid
Molecular Formula C19H23NO4
Molecular Weight 329.4 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC=CC2=CC=CC=C21)CC(=O)O
InChIKey JXDXPRAUFACOHG-OAHLLOKOSA-N
Last Updated: 2025-10-28 07:38

Related Q&A

Compound Q&A

What is (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(1-naphthyl)butanoic acid (CAS: 190190-49-9)?

This compound is a specific organic acid with a molecular structure characterized by a naphthyl grou...

Compound Q&A

What are the main uses of (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(1-naphthyl)butanoic acid (CAS: 190190-49-9)?

This compound is primarily used in pharmaceutical research for its potential therapeutic application...

Compound Q&A

Is (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(1-naphthyl)butanoic acid (CAS: 190190-49-9) safe?

The compound is generally considered safe when handled with appropriate precautions. However, it is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...