Compound Q&A

Is (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(1-naphthyl)butanoic acid (CAS: 190190-49-9) safe?

Answer

(3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(1-naphthyl)butanoic acid
The compound is generally considered safe when handled with appropriate precautions. However, it is important to follow safety guidelines, wear personal protective equipment, and ensure proper ventilation during use. Disposal should be managed according to local regulations.

About

English Name (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(1-naphthyl)butanoic acid
Molecular Formula C19H23NO4
Molecular Weight 329.4 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC=CC2=CC=CC=C21)CC(=O)O
InChIKey JXDXPRAUFACOHG-OAHLLOKOSA-N
Last Updated: 2025-10-28 07:38

Related Q&A

Compound Q&A

What is (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(1-naphthyl)butanoic acid (CAS: 190190-49-9)?

This compound is a specific organic acid with a molecular structure characterized by a naphthyl grou...

Compound Q&A

What are the main uses of (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(1-naphthyl)butanoic acid (CAS: 190190-49-9)?

This compound is primarily used in pharmaceutical research for its potential therapeutic application...

Compound Q&A

How should (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(1-naphthyl)butanoic acid (CAS: 190190-49-9) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...