Compound Q&A

How should Follicle-stimulating hormone (CAS: 97048-13-0) be stored?

Answer

Follicle-stimulating hormone
Follicle-stimulating hormone (FSH) should be stored at a temperature not exceeding 2-8°C (36-46°F) to maintain its efficacy. It should be protected from light and kept in a tightly closed container to prevent degradation. Avoid freezing and ensure the storage area is dry and well-ventilated.

About

CAS No 97048-13-0
English Name Follicle-stimulating hormone
Molecular Formula C42H65N11O12S2
Molecular Weight 980.2 g/mol
SMILES CCC(C)C1C(=O)NC(C(=O)NC(C(=O)NC(CSSCC(C(=O)NC(C(=O)N1)CC2=CC=C(C=C2)O)N)C(=O)N3CCCC3C(=O)NC(CC(C)C)C(=O)NCC(=O)N)CC(=O)N)C(C)O
InChIKey ZDRRIRUAESZNIH-UHFFFAOYSA-N
Last Updated: 2025-10-28 07:38

Related Q&A

Compound Q&A

What is Follicle-stimulating hormone (CAS: 97048-13-0)?

Follicle-stimulating hormone (FSH) is a glycoprotein hormone produced by the anterior pituitary glan...

Compound Q&A

What are the main uses of Follicle-stimulating hormone (CAS: 97048-13-0)?

Follicle-stimulating hormone (FSH) is primarily used in reproductive medicine for the treatment of i...

Compound Q&A

Is Follicle-stimulating hormone (CAS: 97048-13-0) safe?

Follicle-stimulating hormone (FSH) is generally considered safe when used appropriately under medica...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...