Compound Q&A

Is Follicle-stimulating hormone (CAS: 97048-13-0) safe?

Answer

Follicle-stimulating hormone
Follicle-stimulating hormone (FSH) is generally considered safe when used appropriately under medical supervision. However, it should be handled with care to avoid adverse effects such as hypersensitivity reactions. Proper storage and handling protocols should be followed to ensure safety.

About

CAS No 97048-13-0
English Name Follicle-stimulating hormone
Molecular Formula C42H65N11O12S2
Molecular Weight 980.2 g/mol
SMILES CCC(C)C1C(=O)NC(C(=O)NC(C(=O)NC(CSSCC(C(=O)NC(C(=O)N1)CC2=CC=C(C=C2)O)N)C(=O)N3CCCC3C(=O)NC(CC(C)C)C(=O)NCC(=O)N)CC(=O)N)C(C)O
InChIKey ZDRRIRUAESZNIH-UHFFFAOYSA-N
Last Updated: 2025-10-28 07:38

Related Q&A

Compound Q&A

What is Follicle-stimulating hormone (CAS: 97048-13-0)?

Follicle-stimulating hormone (FSH) is a glycoprotein hormone produced by the anterior pituitary glan...

Compound Q&A

What are the main uses of Follicle-stimulating hormone (CAS: 97048-13-0)?

Follicle-stimulating hormone (FSH) is primarily used in reproductive medicine for the treatment of i...

Compound Q&A

How should Follicle-stimulating hormone (CAS: 97048-13-0) be stored?

Follicle-stimulating hormone (FSH) should be stored at a temperature not exceeding 2-8°C (36-46°F) t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...