Compound Q&A

What are the main uses of 6-Bromo-2-chloro-3-methoxyphenylboronic acid (CAS: 957062-55-4)?

Answer

6-Bromo-2-chloro-3-methoxyphenylboronic acid
6-Bromo-2-chloro-3-methoxyphenylboronic acid is primarily used as a key intermediate in the synthesis of pharmaceuticals, particularly in the development of anti-inflammatory and antiviral drugs. It is also utilized in the preparation of functional materials and in academic research for the study of organoboronic acid chemistry and catalytic reactions.

About

English Name 6-Bromo-2-chloro-3-methoxyphenylboronic acid
Molecular Formula C7H7BBrClO3
Molecular Weight 265.3 g/mol
SMILES B(C1=C(C=CC(=C1Cl)OC)Br)(O)O
InChIKey YITPGJUOVXQLPQ-UHFFFAOYSA-N
Last Updated: 2025-10-27 23:53

Related Q&A

Compound Q&A

What is 6-Bromo-2-chloro-3-methoxyphenylboronic acid (CAS: 957062-55-4)?

6-Bromo-2-chloro-3-methoxyphenylboronic acid is an organoboronic acid compound with the CAS number 9...

Compound Q&A

Is 6-Bromo-2-chloro-3-methoxyphenylboronic acid (CAS: 957062-55-4) safe?

6-Bromo-2-chloro-3-methoxyphenylboronic acid is generally considered safe for laboratory use when pr...

Compound Q&A

How should 6-Bromo-2-chloro-3-methoxyphenylboronic acid (CAS: 957062-55-4) be stored?

6-Bromo-2-chloro-3-methoxyphenylboronic acid should be stored in a cool, dry place away from direct ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...