Compound Q&A

What is 6-Bromo-2-chloro-3-methoxyphenylboronic acid (CAS: 957062-55-4)?

Answer

6-Bromo-2-chloro-3-methoxyphenylboronic acid
6-Bromo-2-chloro-3-methoxyphenylboronic acid is an organoboronic acid compound with the CAS number 957062-55-4. It is a white or off-white powder with a molecular formula of C9H7BrClO3B and a molecular weight of approximately 301.04 g/mol. This compound is known for its reactivity in organic synthesis, particularly in the formation of C-C bonds in cross-coupling reactions.

About

English Name 6-Bromo-2-chloro-3-methoxyphenylboronic acid
Molecular Formula C7H7BBrClO3
Molecular Weight 265.3 g/mol
SMILES B(C1=C(C=CC(=C1Cl)OC)Br)(O)O
InChIKey YITPGJUOVXQLPQ-UHFFFAOYSA-N
Last Updated: 2025-10-27 23:53

Related Q&A

Compound Q&A

What are the main uses of 6-Bromo-2-chloro-3-methoxyphenylboronic acid (CAS: 957062-55-4)?

6-Bromo-2-chloro-3-methoxyphenylboronic acid is primarily used as a key intermediate in the synthesi...

Compound Q&A

Is 6-Bromo-2-chloro-3-methoxyphenylboronic acid (CAS: 957062-55-4) safe?

6-Bromo-2-chloro-3-methoxyphenylboronic acid is generally considered safe for laboratory use when pr...

Compound Q&A

How should 6-Bromo-2-chloro-3-methoxyphenylboronic acid (CAS: 957062-55-4) be stored?

6-Bromo-2-chloro-3-methoxyphenylboronic acid should be stored in a cool, dry place away from direct ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...