Compound Q&A

How should 4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid (CAS: 1024594-86-2) be stored?

Answer

4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid
4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid should be stored in a cool, dry place away from direct sunlight and heat sources. It is recommended to store it in a sealed container to maintain its stability. For optimal storage, maintain temperatures below 25°C and relative humidity below 50%. Proper storage conditions are crucial for preserving its chemical integrity and ensuring safe handling.

About

English Name 4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid
Molecular Formula C7H2Br2O2S2
Molecular Weight 342.03 g/mol
SMILES c1c2c(c(sc2Br)Br)sc1C(=O)O
InChIKey LZZZIBXZKLAXSO-UHFFFAOYSA-N
Last Updated: 2025-10-27 20:22

Related Q&A

Compound Q&A

What is 4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid (CAS: 1024594-86-2)?

4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid, also known as 4,6-dibromothieno[3,4-b]thiophene...

Compound Q&A

What are the main uses of 4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid (CAS: 1024594-86-2)?

4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid is primarily used in organic synthesis and resea...

Compound Q&A

Is 4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid (CAS: 1024594-86-2) safe?

4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid, while not inherently hazardous, requires proper...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...