Compound Q&A

What are the main uses of 4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid (CAS: 1024594-86-2)?

Answer

4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid
4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid is primarily used in organic synthesis and research. It serves as a key intermediate in the production of various functional materials and in the development of new pharmaceutical compounds. Its unique chemical structure makes it valuable for studying and designing new organic molecules with specific properties.

About

English Name 4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid
Molecular Formula C7H2Br2O2S2
Molecular Weight 342.03 g/mol
SMILES c1c2c(c(sc2Br)Br)sc1C(=O)O
InChIKey LZZZIBXZKLAXSO-UHFFFAOYSA-N
Last Updated: 2025-10-27 20:22

Related Q&A

Compound Q&A

What is 4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid (CAS: 1024594-86-2)?

4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid, also known as 4,6-dibromothieno[3,4-b]thiophene...

Compound Q&A

Is 4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid (CAS: 1024594-86-2) safe?

4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid, while not inherently hazardous, requires proper...

Compound Q&A

How should 4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid (CAS: 1024594-86-2) be stored?

4,6-Dibromothieno[3,4-b]thiophene-2-carboxylic acid should be stored in a cool, dry place away from ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...