Compound Q&A

What are the main uses of 5,12-Dihydroindolo[3,2-a]carbazole (CAS: 111296-91-4)?

Answer

5,12-Dihydroindolo[3,2-a]carbazole
5,12-Dihydroindolo[3,2-a]carbazole is primarily used in the development of organic light-emitting diodes (OLEDs) and as a precursor in the synthesis of other indolo-carbazole derivatives. It also finds applications in photovoltaic materials and as a component in certain pharmaceuticals and dyes.

About

English Name 5,12-Dihydroindolo[3,2-a]carbazole
Molecular Formula C18H12N2
Molecular Weight 256.31 g/mol
SMILES c1ccc2c(c1)c1c([nH]2)ccc2c1[nH]c1c2cccc1
InChIKey QQWXDAWSMPLECU-UHFFFAOYSA-N
Last Updated: 2025-10-27 20:22

Related Q&A

Compound Q&A

What is 5,12-Dihydroindolo[3,2-a]carbazole (CAS: 111296-91-4)?

5,12-Dihydroindolo[3,2-a]carbazole is an organic compound with a unique molecular structure consisti...

Compound Q&A

Is 5,12-Dihydroindolo[3,2-a]carbazole (CAS: 111296-91-4) safe?

5,12-Dihydroindolo[3,2-a]carbazole is generally considered safe for laboratory use when handled with...

Compound Q&A

How should 5,12-Dihydroindolo[3,2-a]carbazole (CAS: 111296-91-4) be stored?

5,12-Dihydroindolo[3,2-a]carbazole should be stored in a cool, dry place away from direct sunlight a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...