Compound Q&A

What is 5,12-Dihydroindolo[3,2-a]carbazole (CAS: 111296-91-4)?

Answer

5,12-Dihydroindolo[3,2-a]carbazole
5,12-Dihydroindolo[3,2-a]carbazole is an organic compound with a unique molecular structure consisting of a fused heterocyclic ring system. It is characterized by its indolo and carbazole rings, which contribute to its stable electronic properties. This compound can be used in various applications due to its chemical stability and electronic characteristics.

About

English Name 5,12-Dihydroindolo[3,2-a]carbazole
Molecular Formula C18H12N2
Molecular Weight 256.31 g/mol
SMILES c1ccc2c(c1)c1c([nH]2)ccc2c1[nH]c1c2cccc1
InChIKey QQWXDAWSMPLECU-UHFFFAOYSA-N
Last Updated: 2025-10-27 20:22

Related Q&A

Compound Q&A

What are the main uses of 5,12-Dihydroindolo[3,2-a]carbazole (CAS: 111296-91-4)?

5,12-Dihydroindolo[3,2-a]carbazole is primarily used in the development of organic light-emitting di...

Compound Q&A

Is 5,12-Dihydroindolo[3,2-a]carbazole (CAS: 111296-91-4) safe?

5,12-Dihydroindolo[3,2-a]carbazole is generally considered safe for laboratory use when handled with...

Compound Q&A

How should 5,12-Dihydroindolo[3,2-a]carbazole (CAS: 111296-91-4) be stored?

5,12-Dihydroindolo[3,2-a]carbazole should be stored in a cool, dry place away from direct sunlight a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...