Compound Q&A

Is Biotin sulfoxide (CAS: 3376-83-8) safe?

Answer

Biotin sulfoxide
Biotin sulfoxide (CAS: 3376-83-8) is generally considered safe for industrial and research use when handled with appropriate precautions. However, it should be used in a well-ventilated area and with gloves to avoid skin contact. Ingestion or inhalation of the compound should be avoided.

About

CAS No 3376-83-8
English Name Biotin sulfoxide
Molecular Formula C10H16N2O4S
Molecular Weight 260.315 g/mol
SMILES C1C2C(C(S1=O)CCCCC(=O)O)NC(=O)N2
InChIKey KCSKCIQYNAOBNQ-YBSFLMRUSA-N
Last Updated: 2025-10-27 13:14

Related Q&A

Compound Q&A

What is Biotin sulfoxide (CAS: 3376-83-8)?

Biotin sulfoxide (CAS: 3376-83-8) is a chemical compound derived from biotin, featuring a sulfoxide ...

Compound Q&A

What are the main uses of Biotin sulfoxide (CAS: 3376-83-8)?

Biotin sulfoxide (CAS: 3376-83-8) is primarily used in research for protein labeling, drug conjugati...

Compound Q&A

How should Biotin sulfoxide (CAS: 3376-83-8) be stored?

Biotin sulfoxide (CAS: 3376-83-8) should be stored in a tightly sealed container at room temperature...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...