Compound Q&A

Is (3S,5Z,7E)-(26,26,26,27,27,27-~2~H_6_)-9,10-Secocholesta-5,7,10-triene-3,25-diol (CAS: 78782-98-6) safe?

Answer

(3S,5Z,7E)-(26,26,26,27,27,27-~2~H_6_)-9,10-Secocholesta-5,7,10-triene-3,25-diol
This compound is generally considered safe for use in research and pharmaceutical applications when handled with appropriate safety measures. However, it should be stored away from heat and direct sunlight to minimize the risk of degradation. Proper protective equipment, such as gloves and goggles, should be worn during handling.

About

CAS No 78782-98-6
English Name (3S,5Z,7E)-(26,26,26,27,27,27-~2~H_6_)-9,10-Secocholesta-5,7,10-triene-3,25-diol
Molecular Formula C27H38D6O2
Molecular Weight 406.68 g/mol
SMILES CC(CCCC(C)(C)O)C1CCC2C1(CCCC2=CC=C3CC(CCC3=C)O)C
InChIKey JWUBBDSIWDLEOM-QFVHMXLQSA-N
Last Updated: 2025-10-27 13:14

Related Q&A

Compound Q&A

What is (3S,5Z,7E)-(26,26,26,27,27,27-~2~H_6_)-9,10-Secocholesta-5,7,10-triene-3,25-diol (CAS: 78782-98-6)?

This compound is a complex steroid derivative with a unique molecular structure. It contains six hyd...

Compound Q&A

What are the main uses of (3S,5Z,7E)-(26,26,26,27,27,27-~2~H_6_)-9,10-Secocholesta-5,7,10-triene-3,25-diol (CAS: 78782-98-6)?

This compound is primarily used in research and pharmaceutical applications, aiding in the developme...

Compound Q&A

How should (3S,5Z,7E)-(26,26,26,27,27,27-~2~H_6_)-9,10-Secocholesta-5,7,10-triene-3,25-diol (CAS: 78782-98-6) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...