Compound Q&A

How should Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino] (CAS: 168626-74-2) be stored?

Answer

Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino]-
Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino] (CAS: 168626-74-2) should be stored in a cool, dry place, preferably in a sealed container to prevent moisture absorption. It should be kept away from direct sunlight and heat sources. Proper storage conditions will help maintain its stability and prevent any degradation or chemical reactions.

About

English Name Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino]-
Molecular Formula C20H15NO3
Molecular Weight 317.34 g/mol
SMILES OC(=O)c1ccc(cc1)NC(=O)c1ccccc1c1ccccc1
InChIKey VIWLAZSPFNNYTJ-UHFFFAOYSA-N
Last Updated: 2025-10-27 13:14

Related Q&A

Compound Q&A

What is Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino] (CAS: 168626-74-2)?

Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino] (CAS: 168626-74-2) is a chemical compound with...

Compound Q&A

What are the main uses of Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino] (CAS: 168626-74-2)?

Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino] (CAS: 168626-74-2) is primarily used in pharma...

Compound Q&A

Is Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino] (CAS: 168626-74-2) safe?

Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino] (CAS: 168626-74-2) is generally considered saf...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...