Compound Q&A

What are the main uses of Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino] (CAS: 168626-74-2)?

Answer

Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino]-
Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino] (CAS: 168626-74-2) is primarily used in pharmaceuticals for the synthesis of drugs. It also serves as a raw material in the chemical industry for the production of dyes and other organic compounds. Additionally, it is used in research applications and as a component in certain food additives.

About

English Name Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino]-
Molecular Formula C20H15NO3
Molecular Weight 317.34 g/mol
SMILES OC(=O)c1ccc(cc1)NC(=O)c1ccccc1c1ccccc1
InChIKey VIWLAZSPFNNYTJ-UHFFFAOYSA-N
Last Updated: 2025-10-27 13:14

Related Q&A

Compound Q&A

What is Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino] (CAS: 168626-74-2)?

Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino] (CAS: 168626-74-2) is a chemical compound with...

Compound Q&A

Is Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino] (CAS: 168626-74-2) safe?

Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino] (CAS: 168626-74-2) is generally considered saf...

Compound Q&A

How should Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino] (CAS: 168626-74-2) be stored?

Benzoic acid, 4-[([1,1'-biphenyl]-2-ylcarbonyl)amino] (CAS: 168626-74-2) should be stored in a cool,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...