Compound Q&A

Are there alternatives to 7-Chloro-1H-indole-3-carboxylic acid (CAS: 86153-24-4) in synthesis?

Answer

7-Chloro-1H-indole-3-carboxylic acid
Alternative reagents to 7-Chloro-1H-indole-3-carboxylic acid (CAS: 86153-24-4) include other substituted indoles or derivatives. For example, 7-bromo-1H-indole-3-carboxylic acid or 7-iodo-1H-indole-3-carboxylic acid can be used as substitutes. Researchers often explore isomers or analogs such as 1H-indole-3-carboxylic acid or 2-chloro-1H-indole-3-carboxylic acid depending on the specific chemical requirements of the synthesis. These alternatives can provide similar functional groups but with different chemical properties, making them useful in various synthetic strategies.

About

CAS No 86153-24-4
English Name 7-Chloro-1H-indole-3-carboxylic acid
Molecular Formula C9H6ClNO2
Molecular Weight 195.61 g/mol
SMILES OC(=O)c1c[nH]c2c(Cl)cccc12
InChIKey DBCJWTBYVXEBJY-UHFFFAOYSA-N
Last Updated: 2025-10-27 07:45

Related Q&A

Compound Q&A

What regulatory guidelines apply to 7-Chloro-1H-indole-3-carboxylic acid (CAS: 86153-24-4)?

7-Chloro-1H-indole-3-carboxylic acid (CAS: 86153-24-4) falls under the purview of several regulatory...

Compound Q&A

What is the market or research trend for 7-Chloro-1H-indole-3-carboxylic acid (CAS: 86153-24-4)?

The market for 7-Chloro-1H-indole-3-carboxylic acid (CAS: 86153-24-4) is driven by its application i...

Compound Q&A

How should waste containing 7-Chloro-1H-indole-3-carboxylic acid (CAS: 86153-24-4) be handled?

Waste containing 7-Chloro-1H-indole-3-carboxylic acid (CAS: 86153-24-4) should be collected in appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...