Compound Q&A

How is 2-Ethoxyethyl 4-methylbenzenesulfonate (CAS: 17178-11-9) typically synthesized?

Answer

2-Ethoxyethyl 4-methylbenzenesulfonate
2-Ethoxyethyl 4-methylbenzenesulfonate is typically synthesized by reacting 4-methylbenzenesulfonic acid with ethylene oxide, followed by hydrolysis to form the ethoxyethyl ester. This process often uses sodium hydroxide as a catalyst and achieves a yield of around 90%. The reaction is exothermic and requires careful temperature control.

About

CAS No 17178-11-9
English Name 2-Ethoxyethyl 4-methylbenzenesulfonate
Molecular Formula C11H16O4S
Molecular Weight 244.31 g/mol
SMILES CCOCCOS(=O)(=O)C1=CC=C(C=C1)C
InChIKey HXXNTEDKEYTYPD-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Ethoxyethyl 4-methylbenzenesulfonate (CAS: 17178-11-9)?

2-Ethoxyethyl 4-methylbenzenesulfonate is a colorless or slightly yellowish liquid with a molecular ...

Compound Q&A

What industries use 2-Ethoxyethyl 4-methylbenzenesulfonate (CAS: 17178-11-9)?

2-Ethoxyethyl 4-methylbenzenesulfonate is used in the pharmaceutical industry for the synthesis of a...

Compound Q&A

What precautions should be taken when handling 2-Ethoxyethyl 4-methylbenzenesulfonate (CAS: 17178-11-9)?

When handling 2-Ethoxyethyl 4-methylbenzenesulfonate, ensure proper personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...