Compound Q&A

What are the physical and chemical properties of 1,2,3,4,5-Cyclopentanepentayl, compd. with 1-[(1R)-1-[bis(3,5-dimethylphenyl)phosphino]ethyl]-2-(di-1-naphthalenylphosphino)-1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1) (CAS: 851308-40-2)?

Answer

1,2,3,4,5-Cyclopentanepentayl, compd. with 1-[(1R)-1-[bis(3,5-dimethylphenyl)phosphino]ethyl]-2-(di-1-naphthalenylphosphino)-1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1)
This compound is a complex organic iron salt with a crystalline form. It has a high molecular weight due to the presence of multiple cyclopentane rings and phosphine ligands. The compound is soluble in organic solvents like THF and dimethylformamide. It exhibits significant reactivity in coordination chemistry, particularly in catalytic applications. Its solubility and reactivity make it valuable in various chemical transformations.

About

English Name 1,2,3,4,5-Cyclopentanepentayl, compd. with 1-[(1R)-1-[bis(3,5-dimethylphenyl)phosphino]ethyl]-2-(di-1-naphthalenylphosphino)-1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1)
Molecular Formula C48H44FeP2
Molecular Weight 738.67 g/mol
SMILES Cc1cc(cc(c1)P(c2cc(cc(c2)C)C)[C@H](C)[C]3[CH][CH][CH][C]3P(c4cccc5c4cccc5)c6cccc7c6cccc7)C.[CH]1[CH][CH][CH][CH]1.[Fe]
InChIKey IWQSRCJVJZWHFY-HYUNQDLJSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...