Compound Q&A

How is Trihexyl phosphate (CAS: 2528-39-4) typically synthesized?

Answer

Trihexyl phosphate
Trihexyl phosphate (CAS: 2528-39-4) is typically synthesized by esterification of phosphate with hexanol in the presence of sulfuric acid as a catalyst. The reaction involves the conversion of hexanol to hexyl phosphate, which is then further esterified to form the trihexyl phosphate. The yield is around 85-95%, with high selectivity to the desired product.

About

CAS No 2528-39-4
English Name Trihexyl phosphate
Molecular Formula C18H39O4P
Molecular Weight 350.4800000000002 g/mol
SMILES CCCCCCOP(=O)(OCCCCCC)OCCCCCC
InChIKey SFENPMLASUEABX-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Trihexyl phosphate (CAS: 2528-39-4)?

Trihexyl phosphate (CAS: 2528-39-4) is a colorless to light yellow liquid with a molecular weight of...

Compound Q&A

What industries use Trihexyl phosphate (CAS: 2528-39-4)?

Trihexyl phosphate (CAS: 2528-39-4) is widely used in the pharmaceutical industry as a plasticizer a...

Compound Q&A

What precautions should be taken when handling Trihexyl phosphate (CAS: 2528-39-4)?

When handling Trihexyl phosphate (CAS: 2528-39-4), always use personal protective equipment (PPE) su...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...