Compound Q&A

What are the physical and chemical properties of Trihexyl phosphate (CAS: 2528-39-4)?

Answer

Trihexyl phosphate
Trihexyl phosphate (CAS: 2528-39-4) is a colorless to light yellow liquid with a molecular weight of approximately 321.45 g/mol. It has a low volatility and is slightly soluble in water but miscible with most organic solvents. Chemically, it is relatively stable but can react with strong bases and oxidizing agents. It is commonly used as a plasticizer and flame retardant.

About

CAS No 2528-39-4
English Name Trihexyl phosphate
Molecular Formula C18H39O4P
Molecular Weight 350.48 g/mol
SMILES CCCCCCOP(=O)(OCCCCCC)OCCCCCC
InChIKey SFENPMLASUEABX-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:39

Related Q&A

Compound Q&A

How is Trihexyl phosphate (CAS: 2528-39-4) typically synthesized?

Trihexyl phosphate (CAS: 2528-39-4) is typically synthesized by esterification of phosphate with hex...

Compound Q&A

What industries use Trihexyl phosphate (CAS: 2528-39-4)?

Trihexyl phosphate (CAS: 2528-39-4) is widely used in the pharmaceutical industry as a plasticizer a...

Compound Q&A

What precautions should be taken when handling Trihexyl phosphate (CAS: 2528-39-4)?

When handling Trihexyl phosphate (CAS: 2528-39-4), always use personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...